C23H35NO6 — CID 22230783
3-[4-[2-[cyclohexylmethyl(ethoxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22230783) has the molecular formula C23H35NO6 and a molecular weight of 421.53 g/mol. Its IUPAC name is 3-[4-[2-[cyclohexylmethyl(ethoxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[cyclohexylmethyl(ethoxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22230783 |
| Molecular Formula | C23H35NO6 |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 3-[4-[2-[cyclohexylmethyl(ethoxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(=O)N(CCOc1ccc(CC(OCC)C(=O)O)cc1)CC1CCCCC1 |
| InChI | InChI=1S/C23H35NO6/c1-3-28-21(22(25)26)16-18-10-12-20(13-11-18)30-15-14-24(23(27)29-4-2)17-19-8-6-5-7-9-19/h10-13,19,21H,3-9,14-17H2,1-2H3,(H,25,26) |
| InChIKey | QNYSELVHAIJBBU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |