C24H37NO7 — CID 22232929
3-[4-[2-[cyclohexylmethyl(2-methoxyethoxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22232929) has the molecular formula C24H37NO7 and a molecular weight of 451.56 g/mol. Its IUPAC name is 3-[4-[2-[cyclohexylmethyl(2-methoxyethoxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[cyclohexylmethyl(2-methoxyethoxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22232929 |
| Molecular Formula | C24H37NO7 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | 3-[4-[2-[cyclohexylmethyl(2-methoxyethoxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CC2CCCCC2)C(=O)OCCOC)cc1)C(=O)O |
| InChI | InChI=1S/C24H37NO7/c1-3-30-22(23(26)27)17-19-9-11-21(12-10-19)31-14-13-25(24(28)32-16-15-29-2)18-20-7-5-4-6-8-20/h9-12,20,22H,3-8,13-18H2,1-2H3,(H,26,27) |
| InChIKey | MJCJWXZLFSQPAS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|