C24H38N2O5 — CID 22230259
3-[4-[2-[butylcarbamoyl(cyclopentylmethyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22230259) has the molecular formula C24H38N2O5 and a molecular weight of 434.58 g/mol. Its IUPAC name is 3-[4-[2-[butylcarbamoyl(cyclopentylmethyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[butylcarbamoyl(cyclopentylmethyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22230259 |
| Molecular Formula | C24H38N2O5 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | 3-[4-[2-[butylcarbamoyl(cyclopentylmethyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCCCNC(=O)N(CCOc1ccc(CC(OCC)C(=O)O)cc1)CC1CCCC1 |
| InChI | InChI=1S/C24H38N2O5/c1-3-5-14-25-24(29)26(18-20-8-6-7-9-20)15-16-31-21-12-10-19(11-13-21)17-22(23(27)28)30-4-2/h10-13,20,22H,3-9,14-18H2,1-2H3,(H,25,29)(H,27,28) |
| InChIKey | LDPWKYCORPEOSW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|