C24H40N2O5 — CID 22230528
3-[4-[2-[butylcarbamoyl(3,3-dimethylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22230528) has the molecular formula C24H40N2O5 and a molecular weight of 436.59 g/mol. Its IUPAC name is 3-[4-[2-[butylcarbamoyl(3,3-dimethylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[butylcarbamoyl(3,3-dimethylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22230528 |
| Molecular Formula | C24H40N2O5 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.29 |
| IUPAC Name | 3-[4-[2-[butylcarbamoyl(3,3-dimethylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCCCNC(=O)N(CCOc1ccc(CC(OCC)C(=O)O)cc1)CCC(C)(C)C |
| InChI | InChI=1S/C24H40N2O5/c1-6-8-14-25-23(29)26(15-13-24(3,4)5)16-17-31-20-11-9-19(10-12-20)18-21(22(27)28)30-7-2/h9-12,21H,6-8,13-18H2,1-5H3,(H,25,29)(H,27,28) |
| InChIKey | VYPCIAUESJWVJM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|