C29H42N2O5 — CID 22233121
3-[4-[2-[2,2-dimethylpropylcarbamoyl(4-phenylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22233121) has the molecular formula C29H42N2O5 and a molecular weight of 498.66 g/mol. Its IUPAC name is 3-[4-[2-[2,2-dimethylpropylcarbamoyl(4-phenylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[2,2-dimethylpropylcarbamoyl(4-phenylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22233121 |
| Molecular Formula | C29H42N2O5 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.31 |
| IUPAC Name | 3-[4-[2-[2,2-dimethylpropylcarbamoyl(4-phenylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCc2ccccc2)C(=O)NCC(C)(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C29H42N2O5/c1-5-35-26(27(32)33)21-24-14-16-25(17-15-24)36-20-19-31(28(34)30-22-29(2,3)4)18-10-9-13-23-11-7-6-8-12-23/h6-8,11-12,14-17,26H,5,9-10,13,18-22H2,1-4H3,(H,30,34)(H,32,33) |
| InChIKey | GWKWRIMBAVMDJG-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|