C26H33F3N2O6 — CID 22231917
2-ethoxy-3-[4-[2-[3-phenylmethoxypropyl(2,2,2-trifluoroethylcarbamoyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22231917) has the molecular formula C26H33F3N2O6 and a molecular weight of 526.55 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[3-phenylmethoxypropyl(2,2,2-trifluoroethylcarbamoyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[3-phenylmethoxypropyl(2,2,2-trifluoroethylcarbamoyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22231917 |
| Molecular Formula | C26H33F3N2O6 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[3-phenylmethoxypropyl(2,2,2-trifluoroethylcarbamoyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCOCc2ccccc2)C(=O)NCC(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C26H33F3N2O6/c1-2-36-23(24(32)33)17-20-9-11-22(12-10-20)37-16-14-31(25(34)30-19-26(27,28)29)13-6-15-35-18-21-7-4-3-5-8-21/h3-5,7-12,23H,2,6,13-19H2,1H3,(H,30,34)(H,32,33) |
| InChIKey | NFKCDUSKFSMDKH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|