C26H41F3N2O5 — CID 22232226
3-[4-[2-[2,2-dimethylpropylcarbamoyl(7,7,7-trifluoroheptyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22232226) has the molecular formula C26H41F3N2O5 and a molecular weight of 518.62 g/mol. Its IUPAC name is 3-[4-[2-[2,2-dimethylpropylcarbamoyl(7,7,7-trifluoroheptyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[2,2-dimethylpropylcarbamoyl(7,7,7-trifluoroheptyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22232226 |
| Molecular Formula | C26H41F3N2O5 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | 3-[4-[2-[2,2-dimethylpropylcarbamoyl(7,7,7-trifluoroheptyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCCCC(F)(F)F)C(=O)NCC(C)(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C26H41F3N2O5/c1-5-35-22(23(32)33)18-20-10-12-21(13-11-20)36-17-16-31(24(34)30-19-25(2,3)4)15-9-7-6-8-14-26(27,28)29/h10-13,22H,5-9,14-19H2,1-4H3,(H,30,34)(H,32,33) |
| InChIKey | QHBNUNQYXHOGAC-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|