C27H34F3NO6 — CID 22232992
2-ethoxy-3-[4-[2-[phenylmethoxycarbonyl(6,6,6-trifluorohexyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22232992) has the molecular formula C27H34F3NO6 and a molecular weight of 525.56 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[phenylmethoxycarbonyl(6,6,6-trifluorohexyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[phenylmethoxycarbonyl(6,6,6-trifluorohexyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22232992 |
| Molecular Formula | C27H34F3NO6 |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[phenylmethoxycarbonyl(6,6,6-trifluorohexyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCCC(F)(F)F)C(=O)OCc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C27H34F3NO6/c1-2-35-24(25(32)33)19-21-11-13-23(14-12-21)36-18-17-31(16-8-4-7-15-27(28,29)30)26(34)37-20-22-9-5-3-6-10-22/h3,5-6,9-14,24H,2,4,7-8,15-20H2,1H3,(H,32,33) |
| InChIKey | CRQAXOOKTDEUKS-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|