C24H36F3NO7 — CID 22232225
3-[4-[2-[butoxycarbonyl-[2-(4,4,4-trifluorobutoxy)ethyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22232225) has the molecular formula C24H36F3NO7 and a molecular weight of 507.55 g/mol. Its IUPAC name is 3-[4-[2-[butoxycarbonyl-[2-(4,4,4-trifluorobutoxy)ethyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[butoxycarbonyl-[2-(4,4,4-trifluorobutoxy)ethyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22232225 |
| Molecular Formula | C24H36F3NO7 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | 3-[4-[2-[butoxycarbonyl-[2-(4,4,4-trifluorobutoxy)ethyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCCCOC(=O)N(CCOCCCC(F)(F)F)CCOc1ccc(CC(OCC)C(=O)O)cc1 |
| InChI | InChI=1S/C24H36F3NO7/c1-3-5-15-35-23(31)28(12-16-32-14-6-11-24(25,26)27)13-17-34-20-9-7-19(8-10-20)18-21(22(29)30)33-4-2/h7-10,21H,3-6,11-18H2,1-2H3,(H,29,30) |
| InChIKey | YTHKBXMKQWIXTB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|