C24H39NO8 — CID 22230473
2-ethoxy-3-[4-[2-[2-methoxyethoxycarbonyl(2-pentoxyethyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22230473) has the molecular formula C24H39NO8 and a molecular weight of 469.58 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[2-methoxyethoxycarbonyl(2-pentoxyethyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[2-methoxyethoxycarbonyl(2-pentoxyethyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22230473 |
| Molecular Formula | C24H39NO8 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[2-methoxyethoxycarbonyl(2-pentoxyethyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCCCCOCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)OCCOC |
| InChI | InChI=1S/C24H39NO8/c1-4-6-7-14-30-15-12-25(24(28)33-18-17-29-3)13-16-32-21-10-8-20(9-11-21)19-22(23(26)27)31-5-2/h8-11,22H,4-7,12-19H2,1-3H3,(H,26,27) |
| InChIKey | PHGOBVXJXHXRLT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|