C26H34FNO7 — CID 22230307
2-ethoxy-3-[4-[2-[3-(4-fluorophenyl)propyl-(2-methoxyethoxycarbonyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22230307) has the molecular formula C26H34FNO7 and a molecular weight of 491.56 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[3-(4-fluorophenyl)propyl-(2-methoxyethoxycarbonyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[3-(4-fluorophenyl)propyl-(2-methoxyethoxycarbonyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22230307 |
| Molecular Formula | C26H34FNO7 |
| Molecular Weight | 491.56 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[3-(4-fluorophenyl)propyl-(2-methoxyethoxycarbonyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCc2ccc(F)cc2)C(=O)OCCOC)cc1)C(=O)O |
| InChI | InChI=1S/C26H34FNO7/c1-3-33-24(25(29)30)19-21-8-12-23(13-9-21)34-16-15-28(26(31)35-18-17-32-2)14-4-5-20-6-10-22(27)11-7-20/h6-13,24H,3-5,14-19H2,1-2H3,(H,29,30) |
| InChIKey | QOJFHMPPHNEGGJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|