C26H35NO8 — CID 22232309
2-ethoxy-3-[4-[2-[2-methoxyethoxycarbonyl(3-phenoxypropyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22232309) has the molecular formula C26H35NO8 and a molecular weight of 489.57 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[2-methoxyethoxycarbonyl(3-phenoxypropyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[2-methoxyethoxycarbonyl(3-phenoxypropyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22232309 |
| Molecular Formula | C26H35NO8 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[2-methoxyethoxycarbonyl(3-phenoxypropyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCOc2ccccc2)C(=O)OCCOC)cc1)C(=O)O |
| InChI | InChI=1S/C26H35NO8/c1-3-32-24(25(28)29)20-21-10-12-23(13-11-21)34-17-15-27(26(30)35-19-18-31-2)14-7-16-33-22-8-5-4-6-9-22/h4-6,8-13,24H,3,7,14-20H2,1-2H3,(H,28,29) |
| InChIKey | ZRQGEALBJCSKFX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|