C25H39NO7 — CID 22233271
3-[4-[2-[2-butoxyethyl(cyclopentyloxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22233271) has the molecular formula C25H39NO7 and a molecular weight of 465.59 g/mol. Its IUPAC name is 3-[4-[2-[2-butoxyethyl(cyclopentyloxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[2-butoxyethyl(cyclopentyloxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22233271 |
| Molecular Formula | C25H39NO7 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | 3-[4-[2-[2-butoxyethyl(cyclopentyloxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCCCOCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)OC1CCCC1 |
| InChI | InChI=1S/C25H39NO7/c1-3-5-16-30-17-14-26(25(29)33-22-8-6-7-9-22)15-18-32-21-12-10-20(11-13-21)19-23(24(27)28)31-4-2/h10-13,22-23H,3-9,14-19H2,1-2H3,(H,27,28) |
| InChIKey | QGFXCKAQHYMAHB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|