C29H37Cl2NO7 — CID 22231663
3-[4-[2-[cyclopentyloxycarbonyl-[3-[(3,5-dichlorophenyl)methoxy]propyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22231663) has the molecular formula C29H37Cl2NO7 and a molecular weight of 582.52 g/mol. Its IUPAC name is 3-[4-[2-[cyclopentyloxycarbonyl-[3-[(3,5-dichlorophenyl)methoxy]propyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[cyclopentyloxycarbonyl-[3-[(3,5-dichlorophenyl)methoxy]propyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22231663 |
| Molecular Formula | C29H37Cl2NO7 |
| Molecular Weight | 582.52 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | 3-[4-[2-[cyclopentyloxycarbonyl-[3-[(3,5-dichlorophenyl)methoxy]propyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCOCc2cc(Cl)cc(Cl)c2)C(=O)OC2CCCC2)cc1)C(=O)O |
| InChI | InChI=1S/C29H37Cl2NO7/c1-2-37-27(28(33)34)18-21-8-10-25(11-9-21)38-15-13-32(29(35)39-26-6-3-4-7-26)12-5-14-36-20-22-16-23(30)19-24(31)17-22/h8-11,16-17,19,26-27H,2-7,12-15,18,20H2,1H3,(H,33,34) |
| InChIKey | LRLRPWGRMPMGLV-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.52 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|