C29H38Cl2N2O6 — CID 22234011
3-[4-[2-[cyclohexylcarbamoyl-[2-[(3,5-dichlorophenyl)methoxy]ethyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22234011) has the molecular formula C29H38Cl2N2O6 and a molecular weight of 581.54 g/mol. Its IUPAC name is 3-[4-[2-[cyclohexylcarbamoyl-[2-[(3,5-dichlorophenyl)methoxy]ethyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[cyclohexylcarbamoyl-[2-[(3,5-dichlorophenyl)methoxy]ethyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22234011 |
| Molecular Formula | C29H38Cl2N2O6 |
| Molecular Weight | 581.54 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | 3-[4-[2-[cyclohexylcarbamoyl-[2-[(3,5-dichlorophenyl)methoxy]ethyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCOCc2cc(Cl)cc(Cl)c2)C(=O)NC2CCCCC2)cc1)C(=O)O |
| InChI | InChI=1S/C29H38Cl2N2O6/c1-2-38-27(28(34)35)18-21-8-10-26(11-9-21)39-15-13-33(29(36)32-25-6-4-3-5-7-25)12-14-37-20-22-16-23(30)19-24(31)17-22/h8-11,16-17,19,25,27H,2-7,12-15,18,20H2,1H3,(H,32,36)(H,34,35) |
| InChIKey | YXORKEBYPNTOTN-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.54 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|