C23H36N2O5 — CID 22230429
3-[4-[2-[cyclopentylcarbamoyl(2-methylpropyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22230429) has the molecular formula C23H36N2O5 and a molecular weight of 420.55 g/mol. Its IUPAC name is 3-[4-[2-[cyclopentylcarbamoyl(2-methylpropyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[cyclopentylcarbamoyl(2-methylpropyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22230429 |
| Molecular Formula | C23H36N2O5 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | 3-[4-[2-[cyclopentylcarbamoyl(2-methylpropyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CC(C)C)C(=O)NC2CCCC2)cc1)C(=O)O |
| InChI | InChI=1S/C23H36N2O5/c1-4-29-21(22(26)27)15-18-9-11-20(12-10-18)30-14-13-25(16-17(2)3)23(28)24-19-7-5-6-8-19/h9-12,17,19,21H,4-8,13-16H2,1-3H3,(H,24,28)(H,26,27) |
| InChIKey | REIQSGDZKOIBLF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |