C25H35F5N2O6 — CID 22233671
3-[4-[2-[cyclohexylcarbamoyl-[3-(1,1,2,2,2-pentafluoroethoxy)propyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22233671) has the molecular formula C25H35F5N2O6 and a molecular weight of 554.55 g/mol. Its IUPAC name is 3-[4-[2-[cyclohexylcarbamoyl-[3-(1,1,2,2,2-pentafluoroethoxy)propyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[cyclohexylcarbamoyl-[3-(1,1,2,2,2-pentafluoroethoxy)propyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22233671 |
| Molecular Formula | C25H35F5N2O6 |
| Molecular Weight | 554.55 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | 3-[4-[2-[cyclohexylcarbamoyl-[3-(1,1,2,2,2-pentafluoroethoxy)propyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCOC(F)(F)C(F)(F)F)C(=O)NC2CCCCC2)cc1)C(=O)O |
| InChI | InChI=1S/C25H35F5N2O6/c1-2-36-21(22(33)34)17-18-9-11-20(12-10-18)37-16-14-32(23(35)31-19-7-4-3-5-8-19)13-6-15-38-25(29,30)24(26,27)28/h9-12,19,21H,2-8,13-17H2,1H3,(H,31,35)(H,33,34) |
| InChIKey | ANDJZGKCBROHII-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|