C26H40F2N2O6 — CID 22232238
3-[4-[2-[cyclohexylcarbamoyl-[2-(3,3-difluorobutoxy)ethyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22232238) has the molecular formula C26H40F2N2O6 and a molecular weight of 514.61 g/mol. Its IUPAC name is 3-[4-[2-[cyclohexylcarbamoyl-[2-(3,3-difluorobutoxy)ethyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[cyclohexylcarbamoyl-[2-(3,3-difluorobutoxy)ethyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22232238 |
| Molecular Formula | C26H40F2N2O6 |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | 3-[4-[2-[cyclohexylcarbamoyl-[2-(3,3-difluorobutoxy)ethyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCOCCC(C)(F)F)C(=O)NC2CCCCC2)cc1)C(=O)O |
| InChI | InChI=1S/C26H40F2N2O6/c1-3-35-23(24(31)32)19-20-9-11-22(12-10-20)36-18-15-30(14-17-34-16-13-26(2,27)28)25(33)29-21-7-5-4-6-8-21/h9-12,21,23H,3-8,13-19H2,1-2H3,(H,29,33)(H,31,32) |
| InChIKey | DOWVBMDCRQLPTC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|