C25H40N2O5S — CID 22231898
3-[4-[2-[cyclopentylcarbamoyl(3-propylsulfanylpropyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22231898) has the molecular formula C25H40N2O5S and a molecular weight of 480.67 g/mol. Its IUPAC name is 3-[4-[2-[cyclopentylcarbamoyl(3-propylsulfanylpropyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[cyclopentylcarbamoyl(3-propylsulfanylpropyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22231898 |
| Molecular Formula | C25H40N2O5S |
| Molecular Weight | 480.67 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | 3-[4-[2-[cyclopentylcarbamoyl(3-propylsulfanylpropyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCCSCCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C25H40N2O5S/c1-3-17-33-18-7-14-27(25(30)26-21-8-5-6-9-21)15-16-32-22-12-10-20(11-13-22)19-23(24(28)29)31-4-2/h10-13,21,23H,3-9,14-19H2,1-2H3,(H,26,30)(H,28,29) |
| InChIKey | BQYCKDZTNZVHSM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.67 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|