C25H28F6N2O6 — CID 22233273
2-ethoxy-3-[4-[2-[(2-fluorophenyl)carbamoyl-[3-(1,1,2,2,2-pentafluoroethoxy)propyl]amino]ethoxy]phenyl]propanoic acid (PubChem CID 22233273) has the molecular formula C25H28F6N2O6 and a molecular weight of 566.50 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[(2-fluorophenyl)carbamoyl-[3-(1,1,2,2,2-pentafluoroethoxy)propyl]amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[(2-fluorophenyl)carbamoyl-[3-(1,1,2,2,2-pentafluoroethoxy)propyl]amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22233273 |
| Molecular Formula | C25H28F6N2O6 |
| Molecular Weight | 566.50 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[(2-fluorophenyl)carbamoyl-[3-(1,1,2,2,2-pentafluoroethoxy)propyl]amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCOC(F)(F)C(F)(F)F)C(=O)Nc2ccccc2F)cc1)C(=O)O |
| InChI | InChI=1S/C25H28F6N2O6/c1-2-37-21(22(34)35)16-17-8-10-18(11-9-17)38-15-13-33(12-5-14-39-25(30,31)24(27,28)29)23(36)32-20-7-4-3-6-19(20)26/h3-4,6-11,21H,2,5,12-16H2,1H3,(H,32,36)(H,34,35) |
| InChIKey | DJJQKCPJZRKAEM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|