C27H33F5N2O6 — CID 22232621
2-ethoxy-3-[4-[2-[(2-methoxyphenyl)carbamoyl-(5,5,6,6,6-pentafluorohexyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22232621) has the molecular formula C27H33F5N2O6 and a molecular weight of 576.56 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[(2-methoxyphenyl)carbamoyl-(5,5,6,6,6-pentafluorohexyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[(2-methoxyphenyl)carbamoyl-(5,5,6,6,6-pentafluorohexyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22232621 |
| Molecular Formula | C27H33F5N2O6 |
| Molecular Weight | 576.56 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[(2-methoxyphenyl)carbamoyl-(5,5,6,6,6-pentafluorohexyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCC(F)(F)C(F)(F)F)C(=O)Nc2ccccc2OC)cc1)C(=O)O |
| InChI | InChI=1S/C27H33F5N2O6/c1-3-39-23(24(35)36)18-19-10-12-20(13-11-19)40-17-16-34(15-7-6-14-26(28,29)27(30,31)32)25(37)33-21-8-4-5-9-22(21)38-2/h4-5,8-13,23H,3,6-7,14-18H2,1-2H3,(H,33,37)(H,35,36) |
| InChIKey | CVYNECOLGNBMPQ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.56 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|