C28H40N2O6S — CID 22232410
2-ethoxy-3-[4-[2-[(2-methoxyphenyl)carbamoyl-(2-pentylsulfanylethyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22232410) has the molecular formula C28H40N2O6S and a molecular weight of 532.70 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[(2-methoxyphenyl)carbamoyl-(2-pentylsulfanylethyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[(2-methoxyphenyl)carbamoyl-(2-pentylsulfanylethyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22232410 |
| Molecular Formula | C28H40N2O6S |
| Molecular Weight | 532.70 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[(2-methoxyphenyl)carbamoyl-(2-pentylsulfanylethyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCCCCSCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C28H40N2O6S/c1-4-6-9-19-37-20-17-30(28(33)29-24-10-7-8-11-25(24)34-3)16-18-36-23-14-12-22(13-15-23)21-26(27(31)32)35-5-2/h7-8,10-15,26H,4-6,9,16-21H2,1-3H3,(H,29,33)(H,31,32) |
| InChIKey | YYXVXXMYUSVAMI-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.70 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|