C28H39NO7S — CID 22231881
2-ethoxy-3-[4-[2-[(4-methoxyphenoxy)carbonyl-(2-pentylsulfanylethyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22231881) has the molecular formula C28H39NO7S and a molecular weight of 533.69 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[(4-methoxyphenoxy)carbonyl-(2-pentylsulfanylethyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[(4-methoxyphenoxy)carbonyl-(2-pentylsulfanylethyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22231881 |
| Molecular Formula | C28H39NO7S |
| Molecular Weight | 533.69 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[(4-methoxyphenoxy)carbonyl-(2-pentylsulfanylethyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCCCCSCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)Oc1ccc(OC)cc1 |
| InChI | InChI=1S/C28H39NO7S/c1-4-6-7-19-37-20-17-29(28(32)36-25-14-12-23(33-3)13-15-25)16-18-35-24-10-8-22(9-11-24)21-26(27(30)31)34-5-2/h8-15,26H,4-7,16-21H2,1-3H3,(H,30,31) |
| InChIKey | WAYXVYZPXJZIJA-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.69 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|