C24H39NO6S — CID 22232485
3-[4-[2-[2-butylsulfanylethyl(2-methylpropoxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22232485) has the molecular formula C24H39NO6S and a molecular weight of 469.64 g/mol. Its IUPAC name is 3-[4-[2-[2-butylsulfanylethyl(2-methylpropoxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[2-butylsulfanylethyl(2-methylpropoxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22232485 |
| Molecular Formula | C24H39NO6S |
| Molecular Weight | 469.64 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 3-[4-[2-[2-butylsulfanylethyl(2-methylpropoxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCCCSCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)OCC(C)C |
| InChI | InChI=1S/C24H39NO6S/c1-5-7-15-32-16-13-25(24(28)31-18-19(3)4)12-14-30-21-10-8-20(9-11-21)17-22(23(26)27)29-6-2/h8-11,19,22H,5-7,12-18H2,1-4H3,(H,26,27) |
| InChIKey | ZPJZKSOMSDEQFI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.64 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|