C27H37NO7S — CID 22234097
3-[4-[2-[2-butylsulfanylethyl-(4-methoxyphenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22234097) has the molecular formula C27H37NO7S and a molecular weight of 519.66 g/mol. Its IUPAC name is 3-[4-[2-[2-butylsulfanylethyl-(4-methoxyphenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[2-butylsulfanylethyl-(4-methoxyphenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22234097 |
| Molecular Formula | C27H37NO7S |
| Molecular Weight | 519.66 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | 3-[4-[2-[2-butylsulfanylethyl-(4-methoxyphenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCCCSCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)Oc1ccc(OC)cc1 |
| InChI | InChI=1S/C27H37NO7S/c1-4-6-18-36-19-16-28(27(31)35-24-13-11-22(32-3)12-14-24)15-17-34-23-9-7-21(8-10-23)20-25(26(29)30)33-5-2/h7-14,25H,4-6,15-20H2,1-3H3,(H,29,30) |
| InChIKey | VCMYNHQLJOJODJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.66 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|