C28H40N2O5S — CID 22233712
3-[4-[2-[2-butylsulfanylethyl(2-phenylethylcarbamoyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22233712) has the molecular formula C28H40N2O5S and a molecular weight of 516.70 g/mol. Its IUPAC name is 3-[4-[2-[2-butylsulfanylethyl(2-phenylethylcarbamoyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[2-butylsulfanylethyl(2-phenylethylcarbamoyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22233712 |
| Molecular Formula | C28H40N2O5S |
| Molecular Weight | 516.70 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 3-[4-[2-[2-butylsulfanylethyl(2-phenylethylcarbamoyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCCCSCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C28H40N2O5S/c1-3-5-20-36-21-18-30(28(33)29-16-15-23-9-7-6-8-10-23)17-19-35-25-13-11-24(12-14-25)22-26(27(31)32)34-4-2/h6-14,26H,3-5,15-22H2,1-2H3,(H,29,33)(H,31,32) |
| InChIKey | AGBOFBCEDZAQAZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.70 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|