C23H37NO6S — CID 22233185
3-[4-[2-[2-butylsulfanylethyl(propan-2-yloxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22233185) has the molecular formula C23H37NO6S and a molecular weight of 455.62 g/mol. Its IUPAC name is 3-[4-[2-[2-butylsulfanylethyl(propan-2-yloxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[2-butylsulfanylethyl(propan-2-yloxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22233185 |
| Molecular Formula | C23H37NO6S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 3-[4-[2-[2-butylsulfanylethyl(propan-2-yloxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCCCSCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)OC(C)C |
| InChI | InChI=1S/C23H37NO6S/c1-5-7-15-31-16-13-24(23(27)30-18(3)4)12-14-29-20-10-8-19(9-11-20)17-21(22(25)26)28-6-2/h8-11,18,21H,5-7,12-17H2,1-4H3,(H,25,26) |
| InChIKey | VBVAJNUDFYPWEV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|