C27H36Cl2N2O5S — CID 22230543
3-[4-[2-[(2,4-dichlorophenyl)carbamoyl-(2-pentylsulfanylethyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22230543) has the molecular formula C27H36Cl2N2O5S and a molecular weight of 571.57 g/mol. Its IUPAC name is 3-[4-[2-[(2,4-dichlorophenyl)carbamoyl-(2-pentylsulfanylethyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[(2,4-dichlorophenyl)carbamoyl-(2-pentylsulfanylethyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22230543 |
| Molecular Formula | C27H36Cl2N2O5S |
| Molecular Weight | 571.57 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | 3-[4-[2-[(2,4-dichlorophenyl)carbamoyl-(2-pentylsulfanylethyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCCCCSCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H36Cl2N2O5S/c1-3-5-6-16-37-17-14-31(27(34)30-24-12-9-21(28)19-23(24)29)13-15-36-22-10-7-20(8-11-22)18-25(26(32)33)35-4-2/h7-12,19,25H,3-6,13-18H2,1-2H3,(H,30,34)(H,32,33) |
| InChIKey | JDJJMFFQHDVBSX-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.57 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|