C27H35F3N2O6S — CID 22234247
3-[4-[2-[2-butylsulfanylethyl-[[4-(trifluoromethoxy)phenyl]carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22234247) has the molecular formula C27H35F3N2O6S and a molecular weight of 572.65 g/mol. Its IUPAC name is 3-[4-[2-[2-butylsulfanylethyl-[[4-(trifluoromethoxy)phenyl]carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[2-butylsulfanylethyl-[[4-(trifluoromethoxy)phenyl]carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22234247 |
| Molecular Formula | C27H35F3N2O6S |
| Molecular Weight | 572.65 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | 3-[4-[2-[2-butylsulfanylethyl-[[4-(trifluoromethoxy)phenyl]carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCCCSCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C27H35F3N2O6S/c1-3-5-17-39-18-15-32(26(35)31-21-8-12-23(13-9-21)38-27(28,29)30)14-16-37-22-10-6-20(7-11-22)19-24(25(33)34)36-4-2/h6-13,24H,3-5,14-19H2,1-2H3,(H,31,35)(H,33,34) |
| InChIKey | AANFSOVRGJHWSH-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.65 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|