C29H39F3N2O6 — CID 22234592
2-ethoxy-3-[4-[2-[octyl-[[2-(trifluoromethoxy)phenyl]carbamoyl]amino]ethoxy]phenyl]propanoic acid (PubChem CID 22234592) has the molecular formula C29H39F3N2O6 and a molecular weight of 568.63 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[octyl-[[2-(trifluoromethoxy)phenyl]carbamoyl]amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[octyl-[[2-(trifluoromethoxy)phenyl]carbamoyl]amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22234592 |
| Molecular Formula | C29H39F3N2O6 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[octyl-[[2-(trifluoromethoxy)phenyl]carbamoyl]amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCCCCCCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C29H39F3N2O6/c1-3-5-6-7-8-11-18-34(28(37)33-24-12-9-10-13-25(24)40-29(30,31)32)19-20-39-23-16-14-22(15-17-23)21-26(27(35)36)38-4-2/h9-10,12-17,26H,3-8,11,18-21H2,1-2H3,(H,33,37)(H,35,36) |
| InChIKey | XQLBMPYAUYGTAP-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|