C30H44N2O5 — CID 22231139
2-ethoxy-3-[4-[2-[heptyl-[(2,4,5-trimethylphenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid (PubChem CID 22231139) has the molecular formula C30H44N2O5 and a molecular weight of 512.69 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[heptyl-[(2,4,5-trimethylphenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[heptyl-[(2,4,5-trimethylphenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22231139 |
| Molecular Formula | C30H44N2O5 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.33 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[heptyl-[(2,4,5-trimethylphenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCCCCCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)Nc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C30H44N2O5/c1-6-8-9-10-11-16-32(30(35)31-27-20-23(4)22(3)19-24(27)5)17-18-37-26-14-12-25(13-15-26)21-28(29(33)34)36-7-2/h12-15,19-20,28H,6-11,16-18,21H2,1-5H3,(H,31,35)(H,33,34) |
| InChIKey | HKHYFFAIHCBSQN-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|