C33H48N2O5 — CID 22234023
3-[4-[2-[4-cyclohexylbutyl-[(2,4,5-trimethylphenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22234023) has the molecular formula C33H48N2O5 and a molecular weight of 552.76 g/mol. Its IUPAC name is 3-[4-[2-[4-cyclohexylbutyl-[(2,4,5-trimethylphenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[4-cyclohexylbutyl-[(2,4,5-trimethylphenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22234023 |
| Molecular Formula | C33H48N2O5 |
| Molecular Weight | 552.76 g/mol |
| Exact Mass | 552.36 |
| IUPAC Name | 3-[4-[2-[4-cyclohexylbutyl-[(2,4,5-trimethylphenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCC2CCCCC2)C(=O)Nc2cc(C)c(C)cc2C)cc1)C(=O)O |
| InChI | InChI=1S/C33H48N2O5/c1-5-39-31(32(36)37)23-28-14-16-29(17-15-28)40-20-19-35(18-10-9-13-27-11-7-6-8-12-27)33(38)34-30-22-25(3)24(2)21-26(30)4/h14-17,21-22,27,31H,5-13,18-20,23H2,1-4H3,(H,34,38)(H,36,37) |
| InChIKey | YATGRKOIRISBFL-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.76 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|