C32H38Cl2N2O6 — CID 22234638
3-[4-[2-[3-(3,5-dichlorophenoxy)propyl-[(2,4,5-trimethylphenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22234638) has the molecular formula C32H38Cl2N2O6 and a molecular weight of 617.57 g/mol. Its IUPAC name is 3-[4-[2-[3-(3,5-dichlorophenoxy)propyl-[(2,4,5-trimethylphenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[3-(3,5-dichlorophenoxy)propyl-[(2,4,5-trimethylphenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22234638 |
| Molecular Formula | C32H38Cl2N2O6 |
| Molecular Weight | 617.57 g/mol |
| Exact Mass | 616.21 |
| IUPAC Name | 3-[4-[2-[3-(3,5-dichlorophenoxy)propyl-[(2,4,5-trimethylphenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCOc2cc(Cl)cc(Cl)c2)C(=O)Nc2cc(C)c(C)cc2C)cc1)C(=O)O |
| InChI | InChI=1S/C32H38Cl2N2O6/c1-5-40-30(31(37)38)17-24-7-9-27(10-8-24)42-14-12-36(11-6-13-41-28-19-25(33)18-26(34)20-28)32(39)35-29-16-22(3)21(2)15-23(29)4/h7-10,15-16,18-20,30H,5-6,11-14,17H2,1-4H3,(H,35,39)(H,37,38) |
| InChIKey | ZVFJYZYIDAQIPO-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.57 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|