C27H36F2N2O7 — CID 22233842
3-[4-[2-[2-(2,2-difluorobutoxy)ethyl-[(2-methoxyphenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22233842) has the molecular formula C27H36F2N2O7 and a molecular weight of 538.59 g/mol. Its IUPAC name is 3-[4-[2-[2-(2,2-difluorobutoxy)ethyl-[(2-methoxyphenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[2-(2,2-difluorobutoxy)ethyl-[(2-methoxyphenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22233842 |
| Molecular Formula | C27H36F2N2O7 |
| Molecular Weight | 538.59 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | 3-[4-[2-[2-(2,2-difluorobutoxy)ethyl-[(2-methoxyphenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCOCC(F)(F)CC)C(=O)Nc2ccccc2OC)cc1)C(=O)O |
| InChI | InChI=1S/C27H36F2N2O7/c1-4-27(28,29)19-36-16-14-31(26(34)30-22-8-6-7-9-23(22)35-3)15-17-38-21-12-10-20(11-13-21)18-24(25(32)33)37-5-2/h6-13,24H,4-5,14-19H2,1-3H3,(H,30,34)(H,32,33) |
| InChIKey | YDBQSCFVNLJROG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.59 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|