C24H38F2N2O6 — CID 22230770
3-[4-[2-[butan-2-ylcarbamoyl-[2-(2,2-difluorobutoxy)ethyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22230770) has the molecular formula C24H38F2N2O6 and a molecular weight of 488.57 g/mol. Its IUPAC name is 3-[4-[2-[butan-2-ylcarbamoyl-[2-(2,2-difluorobutoxy)ethyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[butan-2-ylcarbamoyl-[2-(2,2-difluorobutoxy)ethyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22230770 |
| Molecular Formula | C24H38F2N2O6 |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | 3-[4-[2-[butan-2-ylcarbamoyl-[2-(2,2-difluorobutoxy)ethyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCOCC(F)(F)CC)C(=O)NC(C)CC)cc1)C(=O)O |
| InChI | InChI=1S/C24H38F2N2O6/c1-5-18(4)27-23(31)28(12-14-32-17-24(25,26)6-2)13-15-34-20-10-8-19(9-11-20)16-21(22(29)30)33-7-3/h8-11,18,21H,5-7,12-17H2,1-4H3,(H,27,31)(H,29,30) |
| InChIKey | SWMFUIIBGGZVFM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|