C23H38N2O6 — CID 22229718
2-ethoxy-3-[4-[2-[propan-2-ylcarbamoyl(3-propoxypropyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22229718) has the molecular formula C23H38N2O6 and a molecular weight of 438.57 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[propan-2-ylcarbamoyl(3-propoxypropyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[propan-2-ylcarbamoyl(3-propoxypropyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22229718 |
| Molecular Formula | C23H38N2O6 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[propan-2-ylcarbamoyl(3-propoxypropyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCCOCCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)NC(C)C |
| InChI | InChI=1S/C23H38N2O6/c1-5-14-29-15-7-12-25(23(28)24-18(3)4)13-16-31-20-10-8-19(9-11-20)17-21(22(26)27)30-6-2/h8-11,18,21H,5-7,12-17H2,1-4H3,(H,24,28)(H,26,27) |
| InChIKey | QRCUYAHCAJCRBP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|