C28H38Cl2N2O6 — CID 22232750
3-[4-[2-[4-[(3,5-dichlorophenyl)methoxy]butyl-(propan-2-ylcarbamoyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22232750) has the molecular formula C28H38Cl2N2O6 and a molecular weight of 569.53 g/mol. Its IUPAC name is 3-[4-[2-[4-[(3,5-dichlorophenyl)methoxy]butyl-(propan-2-ylcarbamoyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[4-[(3,5-dichlorophenyl)methoxy]butyl-(propan-2-ylcarbamoyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22232750 |
| Molecular Formula | C28H38Cl2N2O6 |
| Molecular Weight | 569.53 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | 3-[4-[2-[4-[(3,5-dichlorophenyl)methoxy]butyl-(propan-2-ylcarbamoyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCOCc2cc(Cl)cc(Cl)c2)C(=O)NC(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C28H38Cl2N2O6/c1-4-37-26(27(33)34)17-21-7-9-25(10-8-21)38-14-12-32(28(35)31-20(2)3)11-5-6-13-36-19-22-15-23(29)18-24(30)16-22/h7-10,15-16,18,20,26H,4-6,11-14,17,19H2,1-3H3,(H,31,35)(H,33,34) |
| InChIKey | ZITMHPGJDFYJHS-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.53 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|