C31H33Cl2F2NO7 — CID 22232288
3-[4-[2-[4-[(3,5-dichlorophenyl)methoxy]butyl-(2,4-difluorophenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22232288) has the molecular formula C31H33Cl2F2NO7 and a molecular weight of 640.51 g/mol. Its IUPAC name is 3-[4-[2-[4-[(3,5-dichlorophenyl)methoxy]butyl-(2,4-difluorophenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[4-[(3,5-dichlorophenyl)methoxy]butyl-(2,4-difluorophenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22232288 |
| Molecular Formula | C31H33Cl2F2NO7 |
| Molecular Weight | 640.51 g/mol |
| Exact Mass | 639.16 |
| IUPAC Name | 3-[4-[2-[4-[(3,5-dichlorophenyl)methoxy]butyl-(2,4-difluorophenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCOCc2cc(Cl)cc(Cl)c2)C(=O)Oc2ccc(F)cc2F)cc1)C(=O)O |
| InChI | InChI=1S/C31H33Cl2F2NO7/c1-2-41-29(30(37)38)17-21-5-8-26(9-6-21)42-14-12-36(31(39)43-28-10-7-25(34)19-27(28)35)11-3-4-13-40-20-22-15-23(32)18-24(33)16-22/h5-10,15-16,18-19,29H,2-4,11-14,17,20H2,1H3,(H,37,38) |
| InChIKey | VIMLTPCWWHVWIG-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.51 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|