C31H34Cl2F2N2O6 — CID 22231381
3-[4-[2-[3-[(3,5-dichlorophenyl)methoxy]propyl-[(2,4-difluorophenyl)methylcarbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22231381) has the molecular formula C31H34Cl2F2N2O6 and a molecular weight of 639.52 g/mol. Its IUPAC name is 3-[4-[2-[3-[(3,5-dichlorophenyl)methoxy]propyl-[(2,4-difluorophenyl)methylcarbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[3-[(3,5-dichlorophenyl)methoxy]propyl-[(2,4-difluorophenyl)methylcarbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22231381 |
| Molecular Formula | C31H34Cl2F2N2O6 |
| Molecular Weight | 639.52 g/mol |
| Exact Mass | 638.18 |
| IUPAC Name | 3-[4-[2-[3-[(3,5-dichlorophenyl)methoxy]propyl-[(2,4-difluorophenyl)methylcarbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCOCc2cc(Cl)cc(Cl)c2)C(=O)NCc2ccc(F)cc2F)cc1)C(=O)O |
| InChI | InChI=1S/C31H34Cl2F2N2O6/c1-2-42-29(30(38)39)16-21-4-8-27(9-5-21)43-13-11-37(31(40)36-19-23-6-7-26(34)18-28(23)35)10-3-12-41-20-22-14-24(32)17-25(33)15-22/h4-9,14-15,17-18,29H,2-3,10-13,16,19-20H2,1H3,(H,36,40)(H,38,39) |
| InChIKey | DKEHZQKTHOCONE-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.52 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|