C31H36F2N2O6 — CID 22232612
3-[4-[2-[(2,4-difluorophenyl)methylcarbamoyl-(3-phenylmethoxypropyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22232612) has the molecular formula C31H36F2N2O6 and a molecular weight of 570.63 g/mol. Its IUPAC name is 3-[4-[2-[(2,4-difluorophenyl)methylcarbamoyl-(3-phenylmethoxypropyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[(2,4-difluorophenyl)methylcarbamoyl-(3-phenylmethoxypropyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22232612 |
| Molecular Formula | C31H36F2N2O6 |
| Molecular Weight | 570.63 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | 3-[4-[2-[(2,4-difluorophenyl)methylcarbamoyl-(3-phenylmethoxypropyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCOCc2ccccc2)C(=O)NCc2ccc(F)cc2F)cc1)C(=O)O |
| InChI | InChI=1S/C31H36F2N2O6/c1-2-40-29(30(36)37)19-23-9-13-27(14-10-23)41-18-16-35(15-6-17-39-22-24-7-4-3-5-8-24)31(38)34-21-25-11-12-26(32)20-28(25)33/h3-5,7-14,20,29H,2,6,15-19,21-22H2,1H3,(H,34,38)(H,36,37) |
| InChIKey | YJJDIASCOLGMNE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.63 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|