C23H38N2O6 — CID 22234494
2-ethoxy-3-[4-[2-[3-propoxypropyl(propylcarbamoyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22234494) has the molecular formula C23H38N2O6 and a molecular weight of 438.57 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[3-propoxypropyl(propylcarbamoyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[3-propoxypropyl(propylcarbamoyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22234494 |
| Molecular Formula | C23H38N2O6 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[3-propoxypropyl(propylcarbamoyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCCNC(=O)N(CCCOCCC)CCOc1ccc(CC(OCC)C(=O)O)cc1 |
| InChI | InChI=1S/C23H38N2O6/c1-4-12-24-23(28)25(13-7-16-29-15-5-2)14-17-31-20-10-8-19(9-11-20)18-21(22(26)27)30-6-3/h8-11,21H,4-7,12-18H2,1-3H3,(H,24,28)(H,26,27) |
| InChIKey | RWBNJJLQGYSACT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|