C26H35ClN2O6 — CID 22230381
3-[4-[2-[(4-chlorophenyl)carbamoyl-(3-propoxypropyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22230381) has the molecular formula C26H35ClN2O6 and a molecular weight of 507.03 g/mol. Its IUPAC name is 3-[4-[2-[(4-chlorophenyl)carbamoyl-(3-propoxypropyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[(4-chlorophenyl)carbamoyl-(3-propoxypropyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22230381 |
| Molecular Formula | C26H35ClN2O6 |
| Molecular Weight | 507.03 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 3-[4-[2-[(4-chlorophenyl)carbamoyl-(3-propoxypropyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCCOCCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H35ClN2O6/c1-3-16-33-17-5-14-29(26(32)28-22-10-8-21(27)9-11-22)15-18-35-23-12-6-20(7-13-23)19-24(25(30)31)34-4-2/h6-13,24H,3-5,14-19H2,1-2H3,(H,28,32)(H,30,31) |
| InChIKey | CJSFPIIYMWCIDS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.03 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|