C25H29F5N2O6 — CID 22233299
3-[4-[2-[(3,4-difluorophenyl)carbamoyl-[3-(2,2,2-trifluoroethoxy)propyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22233299) has the molecular formula C25H29F5N2O6 and a molecular weight of 548.51 g/mol. Its IUPAC name is 3-[4-[2-[(3,4-difluorophenyl)carbamoyl-[3-(2,2,2-trifluoroethoxy)propyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[(3,4-difluorophenyl)carbamoyl-[3-(2,2,2-trifluoroethoxy)propyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22233299 |
| Molecular Formula | C25H29F5N2O6 |
| Molecular Weight | 548.51 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | 3-[4-[2-[(3,4-difluorophenyl)carbamoyl-[3-(2,2,2-trifluoroethoxy)propyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCOCC(F)(F)F)C(=O)Nc2ccc(F)c(F)c2)cc1)C(=O)O |
| InChI | InChI=1S/C25H29F5N2O6/c1-2-37-22(23(33)34)14-17-4-7-19(8-5-17)38-13-11-32(10-3-12-36-16-25(28,29)30)24(35)31-18-6-9-20(26)21(27)15-18/h4-9,15,22H,2-3,10-14,16H2,1H3,(H,31,35)(H,33,34) |
| InChIKey | UYCZYJQTWZHHKQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|