C30H34F2N2O5S — CID 22232782
3-[4-[2-[(3,4-difluorophenyl)carbamoyl-(4-phenylsulfanylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22232782) has the molecular formula C30H34F2N2O5S and a molecular weight of 572.67 g/mol. Its IUPAC name is 3-[4-[2-[(3,4-difluorophenyl)carbamoyl-(4-phenylsulfanylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[(3,4-difluorophenyl)carbamoyl-(4-phenylsulfanylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22232782 |
| Molecular Formula | C30H34F2N2O5S |
| Molecular Weight | 572.67 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | 3-[4-[2-[(3,4-difluorophenyl)carbamoyl-(4-phenylsulfanylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCSc2ccccc2)C(=O)Nc2ccc(F)c(F)c2)cc1)C(=O)O |
| InChI | InChI=1S/C30H34F2N2O5S/c1-2-38-28(29(35)36)20-22-10-13-24(14-11-22)39-18-17-34(16-6-7-19-40-25-8-4-3-5-9-25)30(37)33-23-12-15-26(31)27(32)21-23/h3-5,8-15,21,28H,2,6-7,16-20H2,1H3,(H,33,37)(H,35,36) |
| InChIKey | XJUUFPWVRXPIGJ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.67 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|