C30H33F3N2O5S — CID 22233456
2-ethoxy-3-[4-[2-[3-phenylsulfanylpropyl-[[4-(trifluoromethyl)phenyl]carbamoyl]amino]ethoxy]phenyl]propanoic acid (PubChem CID 22233456) has the molecular formula C30H33F3N2O5S and a molecular weight of 590.66 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[3-phenylsulfanylpropyl-[[4-(trifluoromethyl)phenyl]carbamoyl]amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[3-phenylsulfanylpropyl-[[4-(trifluoromethyl)phenyl]carbamoyl]amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22233456 |
| Molecular Formula | C30H33F3N2O5S |
| Molecular Weight | 590.66 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[3-phenylsulfanylpropyl-[[4-(trifluoromethyl)phenyl]carbamoyl]amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCSc2ccccc2)C(=O)Nc2ccc(C(F)(F)F)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C30H33F3N2O5S/c1-2-39-27(28(36)37)21-22-9-15-25(16-10-22)40-19-18-35(17-6-20-41-26-7-4-3-5-8-26)29(38)34-24-13-11-23(12-14-24)30(31,32)33/h3-5,7-16,27H,2,6,17-21H2,1H3,(H,34,38)(H,36,37) |
| InChIKey | GCJVHVCGENDOOH-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.66 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|