C30H33F2NO6S — CID 22230494
3-[4-[2-[(3,4-difluorophenoxy)carbonyl-(4-phenylsulfanylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22230494) has the molecular formula C30H33F2NO6S and a molecular weight of 573.66 g/mol. Its IUPAC name is 3-[4-[2-[(3,4-difluorophenoxy)carbonyl-(4-phenylsulfanylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[(3,4-difluorophenoxy)carbonyl-(4-phenylsulfanylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22230494 |
| Molecular Formula | C30H33F2NO6S |
| Molecular Weight | 573.66 g/mol |
| Exact Mass | 573.20 |
| IUPAC Name | 3-[4-[2-[(3,4-difluorophenoxy)carbonyl-(4-phenylsulfanylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCSc2ccccc2)C(=O)Oc2ccc(F)c(F)c2)cc1)C(=O)O |
| InChI | InChI=1S/C30H33F2NO6S/c1-2-37-28(29(34)35)20-22-10-12-23(13-11-22)38-18-17-33(16-6-7-19-40-25-8-4-3-5-9-25)30(36)39-24-14-15-26(31)27(32)21-24/h3-5,8-15,21,28H,2,6-7,16-20H2,1H3,(H,34,35) |
| InChIKey | ZUJLIXAZNILREZ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.66 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|