C29H39NO6S — CID 22231617
3-[4-[2-[cyclopentyloxycarbonyl(4-phenylsulfanylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22231617) has the molecular formula C29H39NO6S and a molecular weight of 529.70 g/mol. Its IUPAC name is 3-[4-[2-[cyclopentyloxycarbonyl(4-phenylsulfanylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[cyclopentyloxycarbonyl(4-phenylsulfanylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22231617 |
| Molecular Formula | C29H39NO6S |
| Molecular Weight | 529.70 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | 3-[4-[2-[cyclopentyloxycarbonyl(4-phenylsulfanylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCSc2ccccc2)C(=O)OC2CCCC2)cc1)C(=O)O |
| InChI | InChI=1S/C29H39NO6S/c1-2-34-27(28(31)32)22-23-14-16-24(17-15-23)35-20-19-30(29(33)36-25-10-6-7-11-25)18-8-9-21-37-26-12-4-3-5-13-26/h3-5,12-17,25,27H,2,6-11,18-22H2,1H3,(H,31,32) |
| InChIKey | SGMOTDABDFQFBC-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.70 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|