C26H33F2NO6 — CID 22233836
3-[4-[2-[5,5-difluorohexyl(phenoxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22233836) has the molecular formula C26H33F2NO6 and a molecular weight of 493.55 g/mol. Its IUPAC name is 3-[4-[2-[5,5-difluorohexyl(phenoxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[5,5-difluorohexyl(phenoxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22233836 |
| Molecular Formula | C26H33F2NO6 |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | 3-[4-[2-[5,5-difluorohexyl(phenoxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCC(C)(F)F)C(=O)Oc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C26H33F2NO6/c1-3-33-23(24(30)31)19-20-11-13-21(14-12-20)34-18-17-29(16-8-7-15-26(2,27)28)25(32)35-22-9-5-4-6-10-22/h4-6,9-14,23H,3,7-8,15-19H2,1-2H3,(H,30,31) |
| InChIKey | QNUJPMDOOUZINY-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|