C26H32F3NO7 — CID 22233791
3-[4-[2-[2-(3,3-difluorobutoxy)ethyl-(3-fluorophenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22233791) has the molecular formula C26H32F3NO7 and a molecular weight of 527.54 g/mol. Its IUPAC name is 3-[4-[2-[2-(3,3-difluorobutoxy)ethyl-(3-fluorophenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[2-(3,3-difluorobutoxy)ethyl-(3-fluorophenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22233791 |
| Molecular Formula | C26H32F3NO7 |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | 3-[4-[2-[2-(3,3-difluorobutoxy)ethyl-(3-fluorophenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCOCCC(C)(F)F)C(=O)Oc2cccc(F)c2)cc1)C(=O)O |
| InChI | InChI=1S/C26H32F3NO7/c1-3-35-23(24(31)32)17-19-7-9-21(10-8-19)36-16-13-30(12-15-34-14-11-26(2,28)29)25(33)37-22-6-4-5-20(27)18-22/h4-10,18,23H,3,11-17H2,1-2H3,(H,31,32) |
| InChIKey | LHZQXHHREVAJLH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|