C28H29F10NO7 — CID 22232709
2-ethoxy-3-[4-[2-[5,5,6,6,7,7,7-heptafluoroheptyl-[4-(trifluoromethoxy)phenoxy]carbonylamino]ethoxy]phenyl]propanoic acid (PubChem CID 22232709) has the molecular formula C28H29F10NO7 and a molecular weight of 681.52 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[5,5,6,6,7,7,7-heptafluoroheptyl-[4-(trifluoromethoxy)phenoxy]carbonylamino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[5,5,6,6,7,7,7-heptafluoroheptyl-[4-(trifluoromethoxy)phenoxy]carbonylamino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22232709 |
| Molecular Formula | C28H29F10NO7 |
| Molecular Weight | 681.52 g/mol |
| Exact Mass | 681.18 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[5,5,6,6,7,7,7-heptafluoroheptyl-[4-(trifluoromethoxy)phenoxy]carbonylamino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCC(F)(F)C(F)(F)C(F)(F)F)C(=O)Oc2ccc(OC(F)(F)F)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C28H29F10NO7/c1-2-43-22(23(40)41)17-18-5-7-19(8-6-18)44-16-15-39(14-4-3-13-25(29,30)26(31,32)27(33,34)35)24(42)45-20-9-11-21(12-10-20)46-28(36,37)38/h5-12,22H,2-4,13-17H2,1H3,(H,40,41) |
| InChIKey | JYVNVHNGJPDILA-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.52 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|